C8H15NO4 — CID 79028059
N-[(2R)-1-hydroxypropan-2-yl]-1,4-dioxane-2-carboxamide (PubChem CID 79028059) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is N-[(2R)-1-hydroxypropan-2-yl]-1,4-dioxane-2-carboxamide.
| Compound Name | N-[(2R)-1-hydroxypropan-2-yl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 79028059 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-[(2R)-1-hydroxypropan-2-yl]-1,4-dioxane-2-carboxamide |
| SMILES | C[C@H](CO)NC(=O)C1COCCO1 |
| InChI | InChI=1S/C8H15NO4/c1-6(4-10)9-8(11)7-5-12-2-3-13-7/h6-7,10H,2-5H2,1H3,(H,9,11)/t6-,7?/m1/s1 |
| InChIKey | IRZOQKGETAAPTQ-ULUSZKPHSA-N |
| XLogP | -1.10 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |