C6H11NO4 — CID 60756146
N-methoxy-1,4-dioxane-2-carboxamide (PubChem CID 60756146) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is N-methoxy-1,4-dioxane-2-carboxamide.
| Compound Name | N-methoxy-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 60756146 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | N-methoxy-1,4-dioxane-2-carboxamide |
| SMILES | CONC(=O)C1COCCO1 |
| InChI | InChI=1S/C6H11NO4/c1-9-7-6(8)5-4-10-2-3-11-5/h5H,2-4H2,1H3,(H,7,8) |
| InChIKey | QXPSWWKAAKAJAW-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|