C9H14BrNO5 — CID 103492404
methyl 2-bromo-3-(1,4-dioxane-2-carbonylamino)propanoate (PubChem CID 103492404) has the molecular formula C9H14BrNO5 and a molecular weight of 296.12 g/mol. Its IUPAC name is methyl 2-bromo-3-(1,4-dioxane-2-carbonylamino)propanoate.
| Compound Name | methyl 2-bromo-3-(1,4-dioxane-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 103492404 |
| Molecular Formula | C9H14BrNO5 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | methyl 2-bromo-3-(1,4-dioxane-2-carbonylamino)propanoate |
| SMILES | COC(=O)C(Br)CNC(=O)C1COCCO1 |
| InChI | InChI=1S/C9H14BrNO5/c1-14-9(13)6(10)4-11-8(12)7-5-15-2-3-16-7/h6-7H,2-5H2,1H3,(H,11,12) |
| InChIKey | VNWSJVKVBDVVEW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|