C9H18N2O3 — CID 63733447
N-(2-aminobutyl)-1,4-dioxane-2-carboxamide (PubChem CID 63733447) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is N-(2-aminobutyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(2-aminobutyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 63733447 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | N-(2-aminobutyl)-1,4-dioxane-2-carboxamide |
| SMILES | CCC(N)CNC(=O)C1COCCO1 |
| InChI | InChI=1S/C9H18N2O3/c1-2-7(10)5-11-9(12)8-6-13-3-4-14-8/h7-8H,2-6,10H2,1H3,(H,11,12) |
| InChIKey | FVOWZKTZQJQSAL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |