C7H12O6 — CID 143754061
formic acid;methyl 1,4-dioxane-2-carboxylate (PubChem CID 143754061) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is formic acid;methyl 1,4-dioxane-2-carboxylate.
| Compound Name | formic acid;methyl 1,4-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 143754061 |
| Molecular Formula | C7H12O6 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | formic acid;methyl 1,4-dioxane-2-carboxylate |
| SMILES | COC(=O)C1COCCO1.O=CO |
| InChI | InChI=1S/C6H10O4.CH2O2/c1-8-6(7)5-4-9-2-3-10-5;2-1-3/h5H,2-4H2,1H3;1H,(H,2,3) |
| InChIKey | AHUIATVQRDWPEA-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|