C8H14O4 — CID 115278581
1-(1,4-dioxan-2-yl)-2-ethoxyethanone (PubChem CID 115278581) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-2-ethoxyethanone.
| Compound Name | 1-(1,4-dioxan-2-yl)-2-ethoxyethanone |
|---|---|
| PubChem CID | 115278581 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-2-ethoxyethanone |
| SMILES | CCOCC(=O)C1COCCO1 |
| InChI | InChI=1S/C8H14O4/c1-2-10-5-7(9)8-6-11-3-4-12-8/h8H,2-6H2,1H3 |
| InChIKey | OBEJVVGCNOPOGT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |