C13H24O3 — CID 65351055
1-(1,4-dioxan-2-yl)-3-ethylheptan-1-one (PubChem CID 65351055) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-3-ethylheptan-1-one.
| Compound Name | 1-(1,4-dioxan-2-yl)-3-ethylheptan-1-one |
|---|---|
| PubChem CID | 65351055 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-3-ethylheptan-1-one |
| SMILES | CCCCC(CC)CC(=O)C1COCCO1 |
| InChI | InChI=1S/C13H24O3/c1-3-5-6-11(4-2)9-12(14)13-10-15-7-8-16-13/h11,13H,3-10H2,1-2H3 |
| InChIKey | OJTQWBLYSYMBKU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |