C17H24O2S — CID 106600750
1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-3-ethylheptan-1-one (PubChem CID 106600750) has the molecular formula C17H24O2S and a molecular weight of 292.44 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-3-ethylheptan-1-one.
| Compound Name | 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-3-ethylheptan-1-one |
|---|---|
| PubChem CID | 106600750 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-3-ethylheptan-1-one |
| SMILES | CCCCC(CC)CC(=O)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C17H24O2S/c1-3-5-8-13(4-2)11-14(18)16-12-20-17-10-7-6-9-15(17)19-16/h6-7,9-10,13,16H,3-5,8,11-12H2,1-2H3 |
| InChIKey | OUZPLEYQFNPHBB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |