C23H28O2 — CID 57302875
2-benzhydrylidene-4-ethyloctanoic acid (PubChem CID 57302875) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-benzhydrylidene-4-ethyloctanoic acid.
| Compound Name | 2-benzhydrylidene-4-ethyloctanoic acid |
|---|---|
| PubChem CID | 57302875 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2-benzhydrylidene-4-ethyloctanoic acid |
| SMILES | CCCCC(CC)CC(C(=O)O)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28O2/c1-3-5-12-18(4-2)17-21(23(24)25)22(19-13-8-6-9-14-19)20-15-10-7-11-16-20/h6-11,13-16,18H,3-5,12,17H2,1-2H3,(H,24,25) |
| InChIKey | KRWNGJMIUJEYIO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|