C17H29NO2 — CID 175078681
benzoic acid;2-ethyl-N,N-dimethylhexan-1-amine (PubChem CID 175078681) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is benzoic acid;2-ethyl-N,N-dimethylhexan-1-amine.
| Compound Name | benzoic acid;2-ethyl-N,N-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 175078681 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | benzoic acid;2-ethyl-N,N-dimethylhexan-1-amine |
| SMILES | CCCCC(CC)CN(C)C.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C10H23N.C7H6O2/c1-5-7-8-10(6-2)9-11(3)4;8-7(9)6-4-2-1-3-5-6/h10H,5-9H2,1-4H3;1-5H,(H,8,9) |
| InChIKey | IHLKSIHOOAXPRA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |