C15H25N — CID 10021640
(2R)-2-benzyl-N,N-dimethylhexan-1-amine (PubChem CID 10021640) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (2R)-2-benzyl-N,N-dimethylhexan-1-amine.
| Compound Name | (2R)-2-benzyl-N,N-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 10021640 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (2R)-2-benzyl-N,N-dimethylhexan-1-amine |
| SMILES | CCCC[C@H](Cc1ccccc1)CN(C)C |
| InChI | InChI=1S/C15H25N/c1-4-5-9-15(13-16(2)3)12-14-10-7-6-8-11-14/h6-8,10-11,15H,4-5,9,12-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | DACOUCLXJWGELZ-OAHLLOKOSA-N |
| XLogP | 3.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |