About 6-benzyldecylbenzene
6-benzyldecylbenzene (PubChem CID 54156815) has the molecular formula C23H32
and a molecular weight of 308.51 g/mol. Its IUPAC name is 6-benzyldecylbenzene.
Molecular Properties
| Compound Name | 6-benzyldecylbenzene |
| PubChem CID | 54156815 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 6-benzyldecylbenzene |
| SMILES | CCCCC(CCCCCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H32/c1-2-3-13-22(20-23-18-11-6-12-19-23)17-10-5-9-16-21-14-7-4-8-15-21/h4,6-8,11-12,14-15,18-19,22H,2-3,5,9-10,13,16-17,20H2,1H3 |
| InChIKey | JQHVCGHIECBFLR-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-benzyldecylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyldecylbenzene?
The IUPAC name of 6-benzyldecylbenzene (CID 54156815) is 6-benzyldecylbenzene.
What is the SMILES notation for 6-benzyldecylbenzene?
The canonical SMILES for 6-benzyldecylbenzene is CCCCC(CCCCCc1ccccc1)Cc1ccccc1.
What is the InChIKey of 6-benzyldecylbenzene?
The InChIKey is JQHVCGHIECBFLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32/c1-2-3-13-22(20-23-18-11-6-12-19-23)17-10-5-9-16-21-14-7-4-8-15-21/h4,6-8,11-12,14-15,18-19,22H,2-3,5,9-10,13,16-17,20H2,1H3.
What are the key properties of 6-benzyldecylbenzene?
6-benzyldecylbenzene has a molecular weight of 308.51 g/mol, XLogP of 6.84, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyldecylbenzene is sourced from PubChem (CID 54156815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).