About 3-ethylundecylbenzene
3-ethylundecylbenzene (PubChem CID 101046196) has the molecular formula C19H32
and a molecular weight of 260.46 g/mol. Its IUPAC name is 3-ethylundecylbenzene.
Molecular Properties
| Compound Name | 3-ethylundecylbenzene |
| PubChem CID | 101046196 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 3-ethylundecylbenzene |
| SMILES | CCCCCCCCC(CC)CCc1ccccc1 |
| InChI | InChI=1S/C19H32/c1-3-5-6-7-8-10-13-18(4-2)16-17-19-14-11-9-12-15-19/h9,11-12,14-15,18H,3-8,10,13,16-17H2,1-2H3 |
| InChIKey | CZFLESIFMYKJSL-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylundecylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylundecylbenzene?
The IUPAC name of 3-ethylundecylbenzene (CID 101046196) is 3-ethylundecylbenzene.
What is the SMILES notation for 3-ethylundecylbenzene?
The canonical SMILES for 3-ethylundecylbenzene is CCCCCCCCC(CC)CCc1ccccc1.
What is the InChIKey of 3-ethylundecylbenzene?
The InChIKey is CZFLESIFMYKJSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32/c1-3-5-6-7-8-10-13-18(4-2)16-17-19-14-11-9-12-15-19/h9,11-12,14-15,18H,3-8,10,13,16-17H2,1-2H3.
What are the key properties of 3-ethylundecylbenzene?
3-ethylundecylbenzene has a molecular weight of 260.46 g/mol, XLogP of 6.40, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylundecylbenzene is sourced from PubChem (CID 101046196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).