C14H14O2S — CID 106600845
1-(2,3-dihydro-1,4-benzoxathiin-2-yl)hex-5-yn-1-one (PubChem CID 106600845) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)hex-5-yn-1-one.
| Compound Name | 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)hex-5-yn-1-one |
|---|---|
| PubChem CID | 106600845 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)hex-5-yn-1-one |
| SMILES | C#CCCCC(=O)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C14H14O2S/c1-2-3-4-7-11(15)13-10-17-14-9-6-5-8-12(14)16-13/h1,5-6,8-9,13H,3-4,7,10H2 |
| InChIKey | DKTBIPWDYMUGAO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|