C14H16O3S — CID 106600705
2,3-dihydro-1,4-benzoxathiin-2-yl(oxan-4-yl)methanone (PubChem CID 106600705) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzoxathiin-2-yl(oxan-4-yl)methanone.
| Compound Name | 2,3-dihydro-1,4-benzoxathiin-2-yl(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 106600705 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2,3-dihydro-1,4-benzoxathiin-2-yl(oxan-4-yl)methanone |
| SMILES | O=C(C1CCOCC1)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C14H16O3S/c15-14(10-5-7-16-8-6-10)12-9-18-13-4-2-1-3-11(13)17-12/h1-4,10,12H,5-9H2 |
| InChIKey | QWFHYDWRBIRZHO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |