C17H28O — CID 114097291
3-ethyl-1-(3-tricyclo[3.2.1.02,4]octanyl)heptan-1-one (PubChem CID 114097291) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 3-ethyl-1-(3-tricyclo[3.2.1.02,4]octanyl)heptan-1-one.
| Compound Name | 3-ethyl-1-(3-tricyclo[3.2.1.02,4]octanyl)heptan-1-one |
|---|---|
| PubChem CID | 114097291 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 3-ethyl-1-(3-tricyclo[3.2.1.02,4]octanyl)heptan-1-one |
| SMILES | CCCCC(CC)CC(=O)C1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C17H28O/c1-3-5-6-11(4-2)9-14(18)17-15-12-7-8-13(10-12)16(15)17/h11-13,15-17H,3-10H2,1-2H3 |
| InChIKey | LOKGBBDYSHHHFC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |