C17H31N — CID 114097337
3-ethyl-1-(3-tricyclo[3.2.1.02,4]octanyl)heptan-1-amine (PubChem CID 114097337) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is 3-ethyl-1-(3-tricyclo[3.2.1.02,4]octanyl)heptan-1-amine.
| Compound Name | 3-ethyl-1-(3-tricyclo[3.2.1.02,4]octanyl)heptan-1-amine |
|---|---|
| PubChem CID | 114097337 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | 3-ethyl-1-(3-tricyclo[3.2.1.02,4]octanyl)heptan-1-amine |
| SMILES | CCCCC(CC)CC(N)C1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C17H31N/c1-3-5-6-11(4-2)9-14(18)17-15-12-7-8-13(10-12)16(15)17/h11-17H,3-10,18H2,1-2H3 |
| InChIKey | KDYHFJXSZLGTCI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |