C7H12O2 — CID 178036695
2-prop-1-en-2-yl-1,4-dioxane (PubChem CID 178036695) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-prop-1-en-2-yl-1,4-dioxane.
| Compound Name | 2-prop-1-en-2-yl-1,4-dioxane |
|---|---|
| PubChem CID | 178036695 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 2-prop-1-en-2-yl-1,4-dioxane |
| SMILES | C=C(C)C1COCCO1 |
| InChI | InChI=1S/C7H12O2/c1-6(2)7-5-8-3-4-9-7/h7H,1,3-5H2,2H3 |
| InChIKey | XWOVVVZBSPOGOB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|