C6H13N3O2 — CID 62804930
N-amino-N'-methyl-1,4-dioxane-2-carboximidamide (PubChem CID 62804930) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is N-amino-N'-methyl-1,4-dioxane-2-carboximidamide.
| Compound Name | N-amino-N'-methyl-1,4-dioxane-2-carboximidamide |
|---|---|
| PubChem CID | 62804930 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | N-amino-N'-methyl-1,4-dioxane-2-carboximidamide |
| SMILES | C/N=C(\NN)C1COCCO1 |
| InChI | InChI=1S/C6H13N3O2/c1-8-6(9-7)5-4-10-2-3-11-5/h5H,2-4,7H2,1H3,(H,8,9) |
| InChIKey | HPGAEMKFWOCEHY-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|