C6H8F2O2 — CID 23261789
2-[(Z)-1,2-difluoroethenyl]-1,4-dioxane (PubChem CID 23261789) has the molecular formula C6H8F2O2 and a molecular weight of 150.12 g/mol. Its IUPAC name is 2-[(Z)-1,2-difluoroethenyl]-1,4-dioxane.
| Compound Name | 2-[(Z)-1,2-difluoroethenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 23261789 |
| Molecular Formula | C6H8F2O2 |
| Molecular Weight | 150.12 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 2-[(Z)-1,2-difluoroethenyl]-1,4-dioxane |
| SMILES | F/C=C(\F)C1COCCO1 |
| InChI | InChI=1S/C6H8F2O2/c7-3-5(8)6-4-9-1-2-10-6/h3,6H,1-2,4H2/b5-3- |
| InChIKey | JAAPXWPSBRIROJ-HYXAFXHYSA-N |
| XLogP | 1.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.12 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |