C13H22O3 — CID 65350949
(3,4-dimethylcyclohexyl)-(1,4-dioxan-2-yl)methanone (PubChem CID 65350949) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl)-(1,4-dioxan-2-yl)methanone.
| Compound Name | (3,4-dimethylcyclohexyl)-(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 65350949 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (3,4-dimethylcyclohexyl)-(1,4-dioxan-2-yl)methanone |
| SMILES | CC1CCC(C(=O)C2COCCO2)CC1C |
| InChI | InChI=1S/C13H22O3/c1-9-3-4-11(7-10(9)2)13(14)12-8-15-5-6-16-12/h9-12H,3-8H2,1-2H3 |
| InChIKey | LURAWQBBCGAKQB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |