C10H15F3O — CID 64738824
1-(3,4-dimethylcyclohexyl)-2,2,2-trifluoroethanone (PubChem CID 64738824) has the molecular formula C10H15F3O and a molecular weight of 208.22 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 64738824 |
| Molecular Formula | C10H15F3O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-2,2,2-trifluoroethanone |
| SMILES | CC1CCC(C(=O)C(F)(F)F)CC1C |
| InChI | InChI=1S/C10H15F3O/c1-6-3-4-8(5-7(6)2)9(14)10(11,12)13/h6-8H,3-5H2,1-2H3 |
| InChIKey | YZWGSNISVQTMDK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |