C13H24O2 — CID 118389091
tert-butyl (1S)-3,4-dimethylcyclohexane-1-carboxylate (PubChem CID 118389091) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is tert-butyl (1S)-3,4-dimethylcyclohexane-1-carboxylate.
| Compound Name | tert-butyl (1S)-3,4-dimethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118389091 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | tert-butyl (1S)-3,4-dimethylcyclohexane-1-carboxylate |
| SMILES | CC1CC[C@H](C(=O)OC(C)(C)C)CC1C |
| InChI | InChI=1S/C13H24O2/c1-9-6-7-11(8-10(9)2)12(14)15-13(3,4)5/h9-11H,6-8H2,1-5H3/t9?,10?,11-/m0/s1 |
| InChIKey | VRTIZLMOYZBOOJ-ILDUYXDCSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |