C14H25NO — CID 116587119
(3-aminocyclopentyl)-(3,4-dimethylcyclohexyl)methanone (PubChem CID 116587119) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (3-aminocyclopentyl)-(3,4-dimethylcyclohexyl)methanone.
| Compound Name | (3-aminocyclopentyl)-(3,4-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 116587119 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (3-aminocyclopentyl)-(3,4-dimethylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)C2CCC(N)C2)CC1C |
| InChI | InChI=1S/C14H25NO/c1-9-3-4-11(7-10(9)2)14(16)12-5-6-13(15)8-12/h9-13H,3-8,15H2,1-2H3 |
| InChIKey | GKASGOGFCGKWFI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |