About 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one
3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one (PubChem CID 116581016) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one |
| PubChem CID | 116581016 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one |
| SMILES | CC1CCC(C(=O)CC(C)(C)N)CC1C |
| InChI | InChI=1S/C13H25NO/c1-9-5-6-11(7-10(9)2)12(15)8-13(3,4)14/h9-11H,5-8,14H2,1-4H3 |
| InChIKey | IJKKJGLPOMYTNG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one?
The IUPAC name of 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one (CID 116581016) is 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one.
What is the SMILES notation for 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one?
The canonical SMILES for 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one is CC1CCC(C(=O)CC(C)(C)N)CC1C.
What is the InChIKey of 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one?
The InChIKey is IJKKJGLPOMYTNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO/c1-9-5-6-11(7-10(9)2)12(15)8-13(3,4)14/h9-11H,5-8,14H2,1-4H3.
What are the key properties of 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one?
3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one has a molecular weight of 211.35 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(3,4-dimethylcyclohexyl)-3-methylbutan-1-one is sourced from PubChem (CID 116581016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).