C13H24O2 — CID 105105339
1-(3,4-dimethylcyclohexyl)-2-propan-2-yloxyethanone (PubChem CID 105105339) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-2-propan-2-yloxyethanone.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-2-propan-2-yloxyethanone |
|---|---|
| PubChem CID | 105105339 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-2-propan-2-yloxyethanone |
| SMILES | CC(C)OCC(=O)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C13H24O2/c1-9(2)15-8-13(14)12-6-5-10(3)11(4)7-12/h9-12H,5-8H2,1-4H3 |
| InChIKey | RLMPDHPHPMQGLG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |