C18H34O — CID 90160805
1-(3,4-dimethylcyclohexyl)-4,5-dimethyloctan-1-one (PubChem CID 90160805) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-4,5-dimethyloctan-1-one.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-4,5-dimethyloctan-1-one |
|---|---|
| PubChem CID | 90160805 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-4,5-dimethyloctan-1-one |
| SMILES | CCCC(C)C(C)CCC(=O)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C18H34O/c1-6-7-13(2)14(3)9-11-18(19)17-10-8-15(4)16(5)12-17/h13-17H,6-12H2,1-5H3 |
| InChIKey | SPMWPCDEAMOKMO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |