C13H24OS — CID 65129585
1-(3,4-dimethylcyclohexyl)-2-propylsulfanylethanone (PubChem CID 65129585) has the molecular formula C13H24OS and a molecular weight of 228.40 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-2-propylsulfanylethanone.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-2-propylsulfanylethanone |
|---|---|
| PubChem CID | 65129585 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-2-propylsulfanylethanone |
| SMILES | CCCSCC(=O)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C13H24OS/c1-4-7-15-9-13(14)12-6-5-10(2)11(3)8-12/h10-12H,4-9H2,1-3H3 |
| InChIKey | HHNSVUKLHFASPM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|