C17H24O — CID 64739627
1-(3,4-dimethylcyclohexyl)-3-phenylpropan-1-one (PubChem CID 64739627) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-3-phenylpropan-1-one.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 64739627 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-3-phenylpropan-1-one |
| SMILES | CC1CCC(C(=O)CCc2ccccc2)CC1C |
| InChI | InChI=1S/C17H24O/c1-13-8-10-16(12-14(13)2)17(18)11-9-15-6-4-3-5-7-15/h3-7,13-14,16H,8-12H2,1-2H3 |
| InChIKey | JKZVCWQJCJLOBR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |