About 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one
4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one (PubChem CID 116578415) has the molecular formula C18H35NO
and a molecular weight of 281.48 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one |
| PubChem CID | 116578415 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one |
| SMILES | CC1CCC(C(=O)CCC(CCN)C(C)(C)C)CC1C |
| InChI | InChI=1S/C18H35NO/c1-13-6-7-15(12-14(13)2)17(20)9-8-16(10-11-19)18(3,4)5/h13-16H,6-12,19H2,1-5H3 |
| InChIKey | LDXVTUTZVAZKTR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one?
The IUPAC name of 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one (CID 116578415) is 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one.
What is the SMILES notation for 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one?
The canonical SMILES for 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one is CC1CCC(C(=O)CCC(CCN)C(C)(C)C)CC1C.
What is the InChIKey of 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one?
The InChIKey is LDXVTUTZVAZKTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO/c1-13-6-7-15(12-14(13)2)17(20)9-8-16(10-11-19)18(3,4)5/h13-16H,6-12,19H2,1-5H3.
What are the key properties of 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one?
4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one has a molecular weight of 281.48 g/mol, XLogP of 4.42, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-1-(3,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-one is sourced from PubChem (CID 116578415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).