C14H26O2 — CID 116707440
1-(3,4-dimethylcyclohexyl)-2-ethoxybutan-1-one (PubChem CID 116707440) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-2-ethoxybutan-1-one.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-2-ethoxybutan-1-one |
|---|---|
| PubChem CID | 116707440 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-2-ethoxybutan-1-one |
| SMILES | CCOC(CC)C(=O)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C14H26O2/c1-5-13(16-6-2)14(15)12-8-7-10(3)11(4)9-12/h10-13H,5-9H2,1-4H3 |
| InChIKey | PFJPBMGLRAKUAB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |