C11H18O5 — CID 70836224
4-(2-ethoxy-2-hydroxyacetyl)cyclohexane-1-carboxylic acid (PubChem CID 70836224) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 4-(2-ethoxy-2-hydroxyacetyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(2-ethoxy-2-hydroxyacetyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 70836224 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 4-(2-ethoxy-2-hydroxyacetyl)cyclohexane-1-carboxylic acid |
| SMILES | CCOC(O)C(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C11H18O5/c1-2-16-11(15)9(12)7-3-5-8(6-4-7)10(13)14/h7-8,11,15H,2-6H2,1H3,(H,13,14) |
| InChIKey | NWSJZSXSCUCKQN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|