About cyclopropanecarboxylic acid;hydroiodide
cyclopropanecarboxylic acid;hydroiodide (PubChem CID 67700319) has the molecular formula C4H7IO2
and a molecular weight of 214.00 g/mol. Its IUPAC name is cyclopropanecarboxylic acid;hydroiodide.
Molecular Properties
| Compound Name | cyclopropanecarboxylic acid;hydroiodide |
| PubChem CID | 67700319 |
| Molecular Formula | C4H7IO2 |
| Molecular Weight | 214.00 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | cyclopropanecarboxylic acid;hydroiodide |
| SMILES | I.O=C(O)C1CC1 |
| InChI | InChI=1S/C4H6O2.HI/c5-4(6)3-1-2-3;/h3H,1-2H2,(H,5,6);1H |
| InChIKey | ILKCNNDXDTUENY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.00 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cyclopropanecarboxylic acid;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanecarboxylic acid;hydroiodide?
The IUPAC name of cyclopropanecarboxylic acid;hydroiodide (CID 67700319) is cyclopropanecarboxylic acid;hydroiodide.
What is the SMILES notation for cyclopropanecarboxylic acid;hydroiodide?
The canonical SMILES for cyclopropanecarboxylic acid;hydroiodide is I.O=C(O)C1CC1.
What is the InChIKey of cyclopropanecarboxylic acid;hydroiodide?
The InChIKey is ILKCNNDXDTUENY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.HI/c5-4(6)3-1-2-3;/h3H,1-2H2,(H,5,6);1H.
What are the key properties of cyclopropanecarboxylic acid;hydroiodide?
cyclopropanecarboxylic acid;hydroiodide has a molecular weight of 214.00 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanecarboxylic acid;hydroiodide is sourced from PubChem (CID 67700319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).