C9H14O6 — CID 157153528
cyclohexane-1,4-dicarboxylic acid;formic acid (PubChem CID 157153528) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is cyclohexane-1,4-dicarboxylic acid;formic acid.
| Compound Name | cyclohexane-1,4-dicarboxylic acid;formic acid |
|---|---|
| PubChem CID | 157153528 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | cyclohexane-1,4-dicarboxylic acid;formic acid |
| SMILES | O=C(O)C1CCC(C(=O)O)CC1.O=CO |
| InChI | InChI=1S/C8H12O4.CH2O2/c9-7(10)5-1-2-6(4-3-5)8(11)12;2-1-3/h5-6H,1-4H2,(H,9,10)(H,11,12);1H,(H,2,3) |
| InChIKey | ALNQIFHVRCBVGR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|