C15H22O8 — CID 161475893
cyclohexane-1,4-dicarboxylic acid;cyclopentane-1,3-dicarboxylic acid (PubChem CID 161475893) has the molecular formula C15H22O8 and a molecular weight of 330.33 g/mol. Its IUPAC name is cyclohexane-1,4-dicarboxylic acid;cyclopentane-1,3-dicarboxylic acid.
| Compound Name | cyclohexane-1,4-dicarboxylic acid;cyclopentane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 161475893 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | cyclohexane-1,4-dicarboxylic acid;cyclopentane-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)O)C1.O=C(O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C8H12O4.C7H10O4/c9-7(10)5-1-2-6(4-3-5)8(11)12;8-6(9)4-1-2-5(3-4)7(10)11/h5-6H,1-4H2,(H,9,10)(H,11,12);4-5H,1-3H2,(H,8,9)(H,10,11) |
| InChIKey | WDRZLHGZLXPCIT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |