C10H16BrNO3 — CID 131140665
(4-bromo-2-methylpyrrolidin-1-yl)-(1,4-dioxan-2-yl)methanone (PubChem CID 131140665) has the molecular formula C10H16BrNO3 and a molecular weight of 278.15 g/mol. Its IUPAC name is (4-bromo-2-methylpyrrolidin-1-yl)-(1,4-dioxan-2-yl)methanone.
| Compound Name | (4-bromo-2-methylpyrrolidin-1-yl)-(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 131140665 |
| Molecular Formula | C10H16BrNO3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (4-bromo-2-methylpyrrolidin-1-yl)-(1,4-dioxan-2-yl)methanone |
| SMILES | CC1CC(Br)CN1C(=O)C1COCCO1 |
| InChI | InChI=1S/C10H16BrNO3/c1-7-4-8(11)5-12(7)10(13)9-6-14-2-3-15-9/h7-9H,2-6H2,1H3 |
| InChIKey | XNEROXFEFBPRPZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|