1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid

C10H15NO5 — CID 63031794

IUPAC1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(C(=O)C2COCCO2)C1
InChIInChI=1S/C10H15NO5/c12-9(8-6-15-3-4-16-8)11-2-1-7(5-11)10(13)14/h7-8H,1-6H2,(H,13,14)
InChIKeyFLQUCISLTKGBDV-UHFFFAOYSA-N
MW229.23 g/mol
LogP-0.67
Rot. Bonds2

About 1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid

1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 63031794) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid
PubChem CID63031794
Molecular FormulaC10H15NO5
Molecular Weight229.23 g/mol
Exact Mass229.10
IUPAC Name1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(C(=O)C2COCCO2)C1
InChIInChI=1S/C10H15NO5/c12-9(8-6-15-3-4-16-8)11-2-1-7(5-11)10(13)14/h7-8H,1-6H2,(H,13,14)
InChIKeyFLQUCISLTKGBDV-UHFFFAOYSA-N
XLogP-0.67
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.23
LogP ≤ 5-0.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid (CID 63031794) is 1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid is O=C(O)C1CCN(C(=O)C2COCCO2)C1.
What is the InChIKey of 1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid?
The InChIKey is FLQUCISLTKGBDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO5/c12-9(8-6-15-3-4-16-8)11-2-1-7(5-11)10(13)14/h7-8H,1-6H2,(H,13,14).
What are the key properties of 1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid?
1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid has a molecular weight of 229.23 g/mol, XLogP of -0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dioxane-2-carbonyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 63031794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).