(3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid

C11H17NO5 — CID 81125447

IUPAC(3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid
SMILESO=C(O)[C@H]1CCCN(C(=O)C2COCCO2)C1
InChIInChI=1S/C11H17NO5/c13-10(9-7-16-4-5-17-9)12-3-1-2-8(6-12)11(14)15/h8-9H,1-7H2,(H,14,15)/t8-,9?/m0/s1
InChIKeyAKJCVXVCBWFCHQ-IENPIDJESA-N
MW243.26 g/mol
LogP-0.28
Rot. Bonds2

About (3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid

(3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid (PubChem CID 81125447) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is (3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name(3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid
PubChem CID81125447
Molecular FormulaC11H17NO5
Molecular Weight243.26 g/mol
Exact Mass243.11
IUPAC Name(3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid
SMILESO=C(O)[C@H]1CCCN(C(=O)C2COCCO2)C1
InChIInChI=1S/C11H17NO5/c13-10(9-7-16-4-5-17-9)12-3-1-2-8(6-12)11(14)15/h8-9H,1-7H2,(H,14,15)/t8-,9?/m0/s1
InChIKeyAKJCVXVCBWFCHQ-IENPIDJESA-N
XLogP-0.28
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.26
LogP ≤ 5-0.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid?
The IUPAC name of (3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid (CID 81125447) is (3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid.
What is the SMILES notation for (3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid?
The canonical SMILES for (3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid is O=C(O)[C@H]1CCCN(C(=O)C2COCCO2)C1.
What is the InChIKey of (3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid?
The InChIKey is AKJCVXVCBWFCHQ-IENPIDJESA-N. The full InChI is InChI=1S/C11H17NO5/c13-10(9-7-16-4-5-17-9)12-3-1-2-8(6-12)11(14)15/h8-9H,1-7H2,(H,14,15)/t8-,9?/m0/s1.
What are the key properties of (3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid?
(3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid has a molecular weight of 243.26 g/mol, XLogP of -0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(1,4-dioxane-2-carbonyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 81125447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).