C17H27N3O4 — CID 119136251
1-[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]piperidine-3-carboxylic acid (PubChem CID 119136251) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119136251 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)C2CCCN(C(=O)N3CCCC3)C2)C1 |
| InChI | InChI=1S/C17H27N3O4/c21-15(19-9-4-6-14(12-19)16(22)23)13-5-3-10-20(11-13)17(24)18-7-1-2-8-18/h13-14H,1-12H2,(H,22,23) |
| InChIKey | XAJJTNVIDILKTG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |