C12H21N3O3 — CID 81125729
(3S)-1-(4-aminopiperidine-1-carbonyl)piperidine-3-carboxylic acid (PubChem CID 81125729) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is (3S)-1-(4-aminopiperidine-1-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(4-aminopiperidine-1-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81125729 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (3S)-1-(4-aminopiperidine-1-carbonyl)piperidine-3-carboxylic acid |
| SMILES | NC1CCN(C(=O)N2CCC[C@H](C(=O)O)C2)CC1 |
| InChI | InChI=1S/C12H21N3O3/c13-10-3-6-14(7-4-10)12(18)15-5-1-2-9(8-15)11(16)17/h9-10H,1-8,13H2,(H,16,17)/t9-/m0/s1 |
| InChIKey | ISKLZHDEKPOMIX-VIFPVBQESA-N |
| XLogP | 0.33 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |