C12H19NO5 — CID 54899293
2-[1-(1,4-dioxane-2-carbonyl)piperidin-2-yl]acetic acid (PubChem CID 54899293) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-[1-(1,4-dioxane-2-carbonyl)piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-(1,4-dioxane-2-carbonyl)piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 54899293 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-[1-(1,4-dioxane-2-carbonyl)piperidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCCN1C(=O)C1COCCO1 |
| InChI | InChI=1S/C12H19NO5/c14-11(15)7-9-3-1-2-4-13(9)12(16)10-8-17-5-6-18-10/h9-10H,1-8H2,(H,14,15) |
| InChIKey | FKQYAZRWOWSSCV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |