C12H21N3O3 — CID 124699206
2-[(2S)-1-[(2R)-morpholine-2-carbonyl]piperidin-2-yl]acetamide (PubChem CID 124699206) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[(2S)-1-[(2R)-morpholine-2-carbonyl]piperidin-2-yl]acetamide.
| Compound Name | 2-[(2S)-1-[(2R)-morpholine-2-carbonyl]piperidin-2-yl]acetamide |
|---|---|
| PubChem CID | 124699206 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[(2S)-1-[(2R)-morpholine-2-carbonyl]piperidin-2-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1CCCCN1C(=O)[C@H]1CNCCO1 |
| InChI | InChI=1S/C12H21N3O3/c13-11(16)7-9-3-1-2-5-15(9)12(17)10-8-14-4-6-18-10/h9-10,14H,1-8H2,(H2,13,16)/t9-,10+/m0/s1 |
| InChIKey | LRFMVERFLDERSN-VHSXEESVSA-N |
| XLogP | -0.77 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |