C12H20BrNO3 — CID 80665764
[2-(2-bromoethyl)piperidin-1-yl]-(1,4-dioxan-2-yl)methanone (PubChem CID 80665764) has the molecular formula C12H20BrNO3 and a molecular weight of 306.20 g/mol. Its IUPAC name is [2-(2-bromoethyl)piperidin-1-yl]-(1,4-dioxan-2-yl)methanone.
| Compound Name | [2-(2-bromoethyl)piperidin-1-yl]-(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 80665764 |
| Molecular Formula | C12H20BrNO3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | [2-(2-bromoethyl)piperidin-1-yl]-(1,4-dioxan-2-yl)methanone |
| SMILES | O=C(C1COCCO1)N1CCCCC1CCBr |
| InChI | InChI=1S/C12H20BrNO3/c13-5-4-10-3-1-2-6-14(10)12(15)11-9-16-7-8-17-11/h10-11H,1-9H2 |
| InChIKey | GROOSUPDKZCNGB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|