C18H25NO3 — CID 95629661
[(2R)-1,4-dioxan-2-yl]-[(2R)-2-(3-methylphenyl)azepan-1-yl]methanone (PubChem CID 95629661) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is [(2R)-1,4-dioxan-2-yl]-[(2R)-2-(3-methylphenyl)azepan-1-yl]methanone.
| Compound Name | [(2R)-1,4-dioxan-2-yl]-[(2R)-2-(3-methylphenyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 95629661 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [(2R)-1,4-dioxan-2-yl]-[(2R)-2-(3-methylphenyl)azepan-1-yl]methanone |
| SMILES | Cc1cccc([C@H]2CCCCCN2C(=O)[C@H]2COCCO2)c1 |
| InChI | InChI=1S/C18H25NO3/c1-14-6-5-7-15(12-14)16-8-3-2-4-9-19(16)18(20)17-13-21-10-11-22-17/h5-7,12,16-17H,2-4,8-11,13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | FIJAAWXZGPPDLE-IAGOWNOFSA-N |
| XLogP | 2.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |