C12H20O3 — CID 115875404
cycloheptyl(1,4-dioxan-2-yl)methanone (PubChem CID 115875404) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is cycloheptyl(1,4-dioxan-2-yl)methanone.
| Compound Name | cycloheptyl(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 115875404 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | cycloheptyl(1,4-dioxan-2-yl)methanone |
| SMILES | O=C(C1CCCCCC1)C1COCCO1 |
| InChI | InChI=1S/C12H20O3/c13-12(11-9-14-7-8-15-11)10-5-3-1-2-4-6-10/h10-11H,1-9H2 |
| InChIKey | UXUKYYDBSNMOIU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |