C12H20O3 — CID 65351381
1,4-dioxan-2-yl-(3-methylcyclohexyl)methanone (PubChem CID 65351381) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1,4-dioxan-2-yl-(3-methylcyclohexyl)methanone.
| Compound Name | 1,4-dioxan-2-yl-(3-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 65351381 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 1,4-dioxan-2-yl-(3-methylcyclohexyl)methanone |
| SMILES | CC1CCCC(C(=O)C2COCCO2)C1 |
| InChI | InChI=1S/C12H20O3/c1-9-3-2-4-10(7-9)12(13)11-8-14-5-6-15-11/h9-11H,2-8H2,1H3 |
| InChIKey | DFBSXVGNYSVDAZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |