C8H14O2 — CID 86308884
trans-(1S,3S)-3-methylcyclohexane-1-carboxylic acid (PubChem CID 86308884) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is trans-(1S,3S)-3-methylcyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,3S)-3-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 86308884 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | trans-(1S,3S)-3-methylcyclohexane-1-carboxylic acid |
| SMILES | C[C@H]1CCC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C8H14O2/c1-6-3-2-4-7(5-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/t6-,7-/m0/s1 |
| InChIKey | CIFSKZDQGRCLBN-BQBZGAKWSA-N |
| XLogP | 1.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |