C13H22O4 — CID 70371264
cyclohexane-1,3-dicarboxylic acid;2-methylbut-2-ene (PubChem CID 70371264) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is cyclohexane-1,3-dicarboxylic acid;2-methylbut-2-ene.
| Compound Name | cyclohexane-1,3-dicarboxylic acid;2-methylbut-2-ene |
|---|---|
| PubChem CID | 70371264 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | cyclohexane-1,3-dicarboxylic acid;2-methylbut-2-ene |
| SMILES | CC=C(C)C.O=C(O)C1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C8H12O4.C5H10/c9-7(10)5-2-1-3-6(4-5)8(11)12;1-4-5(2)3/h5-6H,1-4H2,(H,9,10)(H,11,12);4H,1-3H3 |
| InChIKey | JSBVCLGUGMHECP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|