C19H38O4 — CID 165044435
methane;3-methylcyclohexane-1-carboxylic acid;methyl 3-methylcyclohexane-1-carboxylate (PubChem CID 165044435) has the molecular formula C19H38O4 and a molecular weight of 330.51 g/mol. Its IUPAC name is methane;3-methylcyclohexane-1-carboxylic acid;methyl 3-methylcyclohexane-1-carboxylate.
| Compound Name | methane;3-methylcyclohexane-1-carboxylic acid;methyl 3-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 165044435 |
| Molecular Formula | C19H38O4 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | methane;3-methylcyclohexane-1-carboxylic acid;methyl 3-methylcyclohexane-1-carboxylate |
| SMILES | C.C.CC1CCCC(C(=O)O)C1.COC(=O)C1CCCC(C)C1 |
| InChI | InChI=1S/C9H16O2.C8H14O2.2CH4/c1-7-4-3-5-8(6-7)9(10)11-2;1-6-3-2-4-7(5-6)8(9)10;;/h7-8H,3-6H2,1-2H3;6-7H,2-5H2,1H3,(H,9,10);2*1H4 |
| InChIKey | OQSBWSJKWYLORJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |