C10H14O6 — CID 23443945
4-methoxycarbonylcyclohexane-1,2-dicarboxylic acid (PubChem CID 23443945) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is 4-methoxycarbonylcyclohexane-1,2-dicarboxylic acid.
| Compound Name | 4-methoxycarbonylcyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 23443945 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 4-methoxycarbonylcyclohexane-1,2-dicarboxylic acid |
| SMILES | COC(=O)C1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C10H14O6/c1-16-10(15)5-2-3-6(8(11)12)7(4-5)9(13)14/h5-7H,2-4H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | DFBFBFAELBRSIY-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |